51022-70-9
| Name | Albuterol sulfate |
| CAS | 51022-70-9 |
| EINECS(EC#) | 242-424-0 |
| Molecular Formula | C13H23NO7S |
| MDL Number | MFCD00148978 |
| Molecular Weight | 337.39 |
| MOL File | 51022-70-9.mol |
Chemical Properties
| Appearance | White Crystalline Solid |
| Melting point | 180 °C |
| Fp | 250 °C |
| storage temp. | 2-8°C |
| solubility | 1 M NaOH: soluble50 mg/ml, clear to slightly hazy, yellow-green |
| form | neat |
| color | White |
| Water Solubility | Soluble in water and 1M sodium hydroxide (50 mg/ml). |
| Usage | ?Adrenergic agonist |
| Merck | 216 |
| BCS Class | 1 |
| Major Application | clinical forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H21NO3.H2O4S/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15;1-5(2,3)4/h4-6,12,14-17H,7-8H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | OVICLFZZVQVVFT-UHFFFAOYSA-N |
| SMILES | CC(C)(NCC(O)C1C=CC(O)=C(CO)C=1)C.S(O)(O)(=O)=O |
| CAS DataBase Reference | 51022-70-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H317-H351-H361fd |
| Precautionary statements | P202-P261-P272-P280-P302+P352-P308+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | ZE4400000 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Repr. 2 Skin Sens. 1 |