
50868-72-9
| Name | 5-Methoxy-2-methylaniline |
| CAS | 50868-72-9 |
| EINECS(EC#) | 256-816-4 |
| Molecular Formula | C8H11NO |
| MDL Number | MFCD00075057 |
| Molecular Weight | 137.18 |
| MOL File | 50868-72-9.mol |
Chemical Properties
| Appearance | White to gray to tan crystalline powder |
| Melting point | 43-46 °C(lit.) |
| Boiling point | 253°C(lit.) |
| density | 1.0630 (rough estimate) |
| refractive index | 1.5647 (estimate) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Powder |
| pka | 4.03±0.10(Predicted) |
| color | Off-white to pale grey to yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H11NO/c1-6-3-4-7(10-2)5-8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | RPJXLEZOFUNGNZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(OC)=CC=C1C |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |