455-38-9
| Name | 3-Fluorobenzoic acid |
| CAS | 455-38-9 |
| EINECS(EC#) | 207-248-0 |
| Molecular Formula | C7H5FO2 |
| MDL Number | MFCD00002489 |
| Molecular Weight | 140.11 |
| MOL File | 455-38-9.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 122-124 °C (lit.) |
| Boiling point | 226.1°C (rough estimate) |
| density | 1.474 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 1.5g/l |
| form | Powder |
| pka | 3.86(at 25℃) |
| color | White to light yellow |
| Water Solubility | Very soluble in water. |
| Detection Methods | GC |
| BRN | 1906920 |
| InChI | InChI=1S/C7H5FO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | MXNBDFWNYRNIBH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(F)=C1 |
| CAS DataBase Reference | 455-38-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 3-fluoro-(455-38-9) |
| EPA Substance Registry System | 455-38-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| Hazard Note | Irritant |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |