
4224-69-5
| Name | Methyl 2-(bromomethyl)acrylate |
| CAS | 4224-69-5 |
| Molecular Formula | C5H7BrO2 |
| MDL Number | MFCD00011697 |
| Molecular Weight | 179.01 |
| MOL File | 4224-69-5.mol |
Chemical Properties
| Appearance | Clear colorless to slightly brownish liquid |
| Boiling point | 35-37 °C/1.3 mmHg (lit.) |
| density | 1.489 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 173 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to slightly brownish |
| BRN | 1852481 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C5H7BrO2/c1-4(3-6)5(7)8-2/h1,3H2,2H3 |
| InChIKey | CFTUQSLVERGMHL-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(CBr)=C |
| CAS DataBase Reference | 4224-69-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 2-(bromomethyl)acrylate(4224-69-5) |
| EPA Substance Registry System | 2-Propenoic acid, 2-(bromomethyl)-, methyl ester (4224-69-5) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | AS4900000 |
| F | 8-10 |
| HS Code | 29161900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

