
36052-24-1
| Name | Methyl 6-aminonicotinate |
| CAS | 36052-24-1 |
| EINECS(EC#) | 629-051-2 |
| Molecular Formula | C7H8N2O2 |
| MDL Number | MFCD00797844 |
| Molecular Weight | 152.15 |
| MOL File | 36052-24-1.mol |
Chemical Properties
| Appearance | Off-White Solid |
| Melting point | 158-162 °C (lit.) |
| Boiling point | 304.5±22.0 °C(Predicted) |
| density | 1.238±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Powder |
| pka | 4.78±0.13(Predicted) |
| color | White to light yellow-beige or pink |
| Usage | Used in ointments for treatment of psoriasis. |
| Detection Methods | HPLC |
| InChI | InChI=1S/C7H8N2O2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3,(H2,8,9) |
| InChIKey | JACPDLJUQLKABC-UHFFFAOYSA-N |
| SMILES | C1=NC(N)=CC=C1C(OC)=O |
| CAS DataBase Reference | 36052-24-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
