34846-64-5
| Name | 3-Cyanoquinoline |
| CAS | 34846-64-5 |
| EINECS(EC#) | 252-248-6 |
| Molecular Formula | C10H6N2 |
| MDL Number | MFCD00006766 |
| Molecular Weight | 154.17 |
| MOL File | 34846-64-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 108-110 °C (lit.) |
| Boiling point | 323.7±15.0 °C(Predicted) |
| density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| pka | 1.72±0.11(Predicted) |
| color | White to off-white |
| Detection Methods | HPLC |
| InChI | InChI=1S/C10H6N2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-5,7H |
| InChIKey | QZZYYBQGTSGDPP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=C(C#N)C=1 |
| CAS DataBase Reference | 34846-64-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Quinolinecarbonitrile(34846-64-5) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |