
1518-16-7
| Name | 7,7,8,8-Tetracyanoquinodimethane |
| CAS | 1518-16-7 |
| EINECS(EC#) | 216-174-8 |
| Molecular Formula | C12H4N4 |
| MDL Number | MFCD00011664 |
| Molecular Weight | 204.19 |
| MOL File | 1518-16-7.mol |
Chemical Properties
| Appearance | orange to green crystalline powder |
| Melting point | 287-289 °C (dec.) (lit.) |
| Boiling point | 332.67°C (rough estimate) |
| density | 1.3596 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Orange-brown to green |
| Stability: | Stable. Incompatible with strong acids, strong bases, strong reducing agents, strong oxidizing agents. |
| Water Solubility | insoluble |
| semiconductor properties | N-type (mobility=10-5cm2/V·s) |
| λmax | 395nm(CH3CN)(lit.) |
| BRN | 611604 |
| InChI | InChI=1S/C12H4N4/c13-5-11(6-14)9-1-2-10(4-3-9)12(7-15)8-16/h1-4H |
| InChIKey | PCCVSPMFGIFTHU-UHFFFAOYSA-N |
| SMILES | C1(=C(C#N)C#N)C=CC(=C(C#N)C#N)C=C1 |c:8,t:0| |
| CAS DataBase Reference | 1518-16-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanedinitrile, 2,2'-(2,5-cyclohexadiene-1,4-diylidene)bis-(1518-16-7) |
| EPA Substance Registry System | 1518-16-7(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | GU4850000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29269095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |
