3228-02-2
| Name | 4-ISOPROPYL-3-METHYLPHENOL |
| CAS | 3228-02-2 |
| EINECS(EC#) | 221-761-7 |
| Molecular Formula | C10H14O |
| MDL Number | MFCD00010704 |
| Molecular Weight | 150.22 |
| MOL File | 3228-02-2.mol |
Chemical Properties
| Melting point | 111-114 °C(lit.) |
| Boiling point | 246 °C |
| density | 0.9688 (estimate) |
| vapor pressure | 1.81Pa at 25℃ |
| refractive index | 1.5115 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 10.36±0.18(Predicted) |
| color | White to Almost white |
| Water Solubility | 210mg/L at 20℃ |
| Cosmetics Ingredients Functions | DEODORANT PRESERVATIVE ANTIMICROBIAL |
| InChI | InChI=1S/C10H14O/c1-7(2)10-5-4-9(11)6-8(10)3/h4-7,11H,1-3H3 |
| InChIKey | IJALWSVNUBBQRA-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(C)C)C(C)=C1 |
| LogP | 3.43 |
| CAS DataBase Reference | 3228-02-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1759 |
| WGK Germany | 2 |
| RTECS | GZ7170000 |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29071990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |