
362-07-2
| Name | 2-METHOXYESTRADIOL |
| CAS | 362-07-2 |
| EINECS(EC#) | 263-807-9 |
| Molecular Formula | C19H26O3 |
| MDL Number | MFCD00010489 |
| Molecular Weight | 302.41 |
| MOL File | 362-07-2.mol |
Chemical Properties
| Appearance | Off-White Solid |
| Melting point | 188-190°C |
| Boiling point | 464.4±45.0 °C(Predicted) |
| density | 1.178±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMSO: 10 mg/mL |
| form | crystalline |
| pka | 10.29±0.60(Predicted) |
| color | light yellow |
| Usage | A natural metabolite of 17?Estradiol which is devoid of estrogenic activity. Inhibits cell proliferation and angiogenesis. Binds to the colchicine binding site of tubulin, and has been suggested to function as a natural regulator of microtubule a |
| λmax | 286nm(EtOH)(lit.) |
| InChI | InChI=1/C19H26O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,18,20-21H,3-8H2,1-2H3/t12-,13+,15-,18-,19-/s3 |
| InChIKey | CQOQDQWUFQDJMK-SSTWWWIQSA-N |
| SMILES | C[C@@]12[C@H](CC[C@@]1([H])[C@]1([H])CCC3C=C(O)C(OC)=CC=3[C@@]1([H])CC2)O |&1:1,2,5,7,20,r| |
| CAS DataBase Reference | 362-07-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335-H350-H360-H372-H410 |
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | KG7537500 |
| HS Code | 2937.23.5050 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 STOT SE 3 |


