552-22-7
| Name | THYMOL IODIDE |
| CAS | 552-22-7 |
| EINECS(EC#) | 209-007-5 |
| Molecular Formula | C20H24I2O2 |
| MDL Number | MFCD00026409 |
| Molecular Weight | 550.21 |
| MOL File | 552-22-7.mol |
Chemical Properties
| Appearance | reddish-brown or yellow crystalline powder |
| Boiling point | 479.0±55.0 °C(Predicted) |
| density | 1.617±0.06 g/cm3(Predicted) |
| vapor pressure | 0.014Pa at 20℃ |
| storage temp. | 2-8°C |
| solubility | DMSO: < 1 mg/mL (insoluble or slightly soluble) |
| form | Solid |
| color | Light yellow to yellow |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C20H24I2O2/c1-11(2)15-9-17(13(5)7-19(15)23-21)18-10-16(12(3)4)20(24-22)8-14(18)6/h7-12H,1-6H3 |
| InChIKey | SHOKWSLXDAIZPP-UHFFFAOYSA-N |
| SMILES | CC1=CC(OI)=C(C(C)C)C=C1C1C(=CC(OI)=C(C(C)C)C=1)C |
| LogP | 8.573 (est) |
| Uses | |
| CAS DataBase Reference | 552-22-7(CAS DataBase Reference) |
| EPA Substance Registry System | Thymol iodide (552-22-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 552-22-7(Hazardous Substances Data) |