31139-36-3
| Name | Dibenzyl dicarbonate |
| CAS | 31139-36-3 |
| Molecular Formula | C16H18O6 |
| MDL Number | MFCD00043124 |
| Molecular Weight | 306.31 |
| MOL File | 31139-36-3.mol |
Chemical Properties
| Melting point | 29-32 °C (lit.) |
| Boiling point | 388.65°C (rough estimate) |
| density | 1.17 g/mL at 25 °C(lit.) |
| refractive index | 1.5000 (estimate) |
| Fp | >230 °F |
| storage temp. | −20°C |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 4324796 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C16H14O5/c17-15(19-11-13-7-3-1-4-8-13)21-16(18)20-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | FHRRJZZGSJXPRQ-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)COC(=O)OC(=O)OCC1C=CC=CC=1 |
| CAS DataBase Reference | 31139-36-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 4.4-10-21 |
| HS Code | 29209090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |