30544-47-9
| Name | Etofenamate |
| CAS | 30544-47-9 |
| EINECS(EC#) | 250-231-8 |
| Molecular Formula | C18H18F3NO4 |
| MDL Number | MFCD00242806 |
| Molecular Weight | 369.33 |
| MOL File | 30544-47-9.mol |
Chemical Properties
| Melting point | 25°C |
| Boiling point | bp.001 130-135° |
| density | 1.2866 (estimate) |
| refractive index | nD25 1.564 |
| storage temp. | Refrigerator |
| solubility | Practically insoluble in water, miscible with ethanol (96 per cent) and with ethyl acetate. |
| form | neat |
| pka | 14.32±0.10(Predicted) |
| color | Light yellow to yellow |
| Stability: | Light Sensitive |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C18H18F3NO4/c19-18(20,21)13-4-3-5-14(12-13)22-16-7-2-1-6-15(16)17(24)26-11-10-25-9-8-23/h1-7,12,22-23H,8-11H2 |
| InChIKey | XILVEPYQJIOVNB-UHFFFAOYSA-N |
| SMILES | C(OCCOCCO)(=O)C1=CC=CC=C1NC1=CC=CC(C(F)(F)F)=C1 |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H410 |
| Precautionary statements | P301+P330+P331+P310 |
| RIDADR | UN2810 - class 6.1 - PG 3 - EHS - Toxic, liquids, organic, n.o.s., HI: all |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity |