301-10-0
| Name | Stannous octoate |
| CAS | 301-10-0 |
| EINECS(EC#) | 206-108-6 |
| Molecular Formula | C16H30O4Sn |
| MDL Number | MFCD00002676 |
| Molecular Weight | 405.12 |
| MOL File | 301-10-0.mol |
Chemical Properties
| Melting point | <-20°C |
| Boiling point | >200°C |
| density | 1.251 g/mL at 25 °C(lit.) |
| vapor pressure | 0.3Pa at 20℃ |
| refractive index | n |
| Fp | >110°C |
| form | liquid |
| pka | 5.09[at 20 ℃] |
| color | viscous |
| Specific Gravity | 1.251 |
| Water Solubility | Miscible with water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/2C8H16O2.Sn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | KSBAEPSJVUENNK-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)C(=O)O[SnH2]OC(=O)C(CC)CCCC |
| LogP | 2.64 at 25℃ |
| CAS DataBase Reference | 301-10-0(CAS DataBase Reference) |
| EPA Substance Registry System | 301-10-0(EPA Substance) |
Safety Data
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H318-H361-H412 |
| Precautionary statements | P201-P273-P280-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| RTECS | MO7870000 |
| TSCA | Yes |
| REACH Registrations | Active |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 Repr. 1B Skin Sens. 1 |