30007-47-7
| Name | 5-Bromo-5-nitro-1,3-dioxane |
| CAS | 30007-47-7 |
| EINECS(EC#) | 250-001-7 |
| Molecular Formula | C4H6BrNO4 |
| MDL Number | MFCD00101855 |
| Molecular Weight | 212 |
| MOL File | 30007-47-7.mol |
Chemical Properties
| Melting point | 58-60 °C |
| Boiling point | 280.8±40.0 °C(Predicted) |
| density | 1.070 |
| vapor pressure | 1.6Pa at 20℃ |
| refractive index | 1.6200 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS(pH 7.2) (1:4): 0.2 mg/ml; Ethanol: 25 mg/ml |
| form | neat |
| color | White to Almost white |
| Water Solubility | Soluble in water at 12.5mg/ml |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| Cosmetic Ingredient Review (CIR) | 5-Bromo-5-nitro-1,3-dioxane (30007-47-7) |
| InChI | InChI=1S/C4H6BrNO4/c5-4(6(7)8)1-9-3-10-2-4/h1-3H2 |
| InChIKey | XVBRCOKDZVQYAY-UHFFFAOYSA-N |
| SMILES | O1CC(Br)([N+]([O-])=O)COC1 |
| LogP | 1.6 at 23℃ |
| CAS DataBase Reference | 30007-47-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Dioxane, 5-bromo-5-nitro-(30007-47-7) |
Safety Data
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H314-H410 |
| Precautionary statements | P260-P273-P280-P301+P312+P330-P303+P361+P353-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | JG9650000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29329990 |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1A |