| Appearance |
white to light yellow crystal powde |
| Melting point |
98 °C |
| Boiling point |
265.51°C (rough estimate) |
| density |
1.6841 (rough estimate) |
| refractive index |
1.6120 (estimate) |
| storage temp. |
Store at RT. |
| solubility |
soluble in Chloroform, Ethyl Acetate |
| form |
Crystalline Powder |
| color |
Light yellow to beige |
| Stability: |
Stable. Incomaptible with bases, amines, oxidizing agents, alcohols. May be moisture sensitive. Corrodes steel. |
| Water Solubility |
It hydrolyzes in water. Soluble in alcohol and ether. |
| BRN |
742796 |
| InChI |
InChI=1S/C7H6BrNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 |
| InChIKey |
VOLRSQPSJGXRNJ-UHFFFAOYSA-N |
| SMILES |
C1(CBr)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference |
100-11-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzene, 1-(bromomethyl)-4-nitro-(100-11-8) |
| EPA Substance Registry System |
100-11-8(EPA Substance) |
