100-11-8
| Name | 4-Nitrobenzyl bromide |
| CAS | 100-11-8 |
| EINECS(EC#) | 202-820-6 |
| Molecular Formula | C7H6BrNO2 |
| MDL Number | MFCD00007373 |
| Molecular Weight | 216.03 |
| MOL File | 100-11-8.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 98 °C |
| Boiling point | 265.51°C (rough estimate) |
| density | 1.6841 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Store at RT. |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| color | Light yellow to beige |
| Stability: | Stable. Incomaptible with bases, amines, oxidizing agents, alcohols. May be moisture sensitive. Corrodes steel. |
| Water Solubility | It hydrolyzes in water. Soluble in alcohol and ether. |
| BRN | 742796 |
| InChI | InChI=1S/C7H6BrNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 |
| InChIKey | VOLRSQPSJGXRNJ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 100-11-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-(bromomethyl)-4-nitro-(100-11-8) |
| EPA Substance Registry System | 100-11-8(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XS7967000 |
| F | 10-19-21 |
| Hazard Note | Irritant/Corrosive |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049085 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |