
2942-59-8
| Name | 2-Chloronicotinic acid |
| CAS | 2942-59-8 |
| EINECS(EC#) | 220-937-0 |
| Molecular Formula | C6H4ClNO2 |
| MDL Number | MFCD00006236 |
| Molecular Weight | 157.55 |
| MOL File | 2942-59-8.mol |
Chemical Properties
| Appearance | White to cream powder |
| Melting point | 176-178 °C (dec.)(lit.) |
| Boiling point | 316.8±22.0 °C(Predicted) |
| density | 1.470±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO, Ethyl Acetate (Slightly) |
| form | Powder |
| pka | 2.07±0.25(Predicted) |
| color | White to cream |
| Odor | Pungent odor |
| Detection Methods | HPLC |
| BRN | 119023 |
| InChI | InChI=1S/C6H4ClNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H,9,10) |
| InChIKey | IBRSSZOHCGUTHI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1C(O)=O |
| LogP | 0.988 |
| CAS DataBase Reference | 2942-59-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2942-59-8(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | T |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
