2872-52-8
| Name | Disperse Red 1 |
| CAS | 2872-52-8 |
| EINECS(EC#) | 220-704-3 |
| Molecular Formula | C16H18N4O3 |
| MDL Number | MFCD00007312 |
| Molecular Weight | 314.34 |
| MOL File | 2872-52-8.mol |
Chemical Properties
| Melting point | 160-162 °C (lit.) |
| Boiling point | 454.02°C (rough estimate) |
| density | 1.1523 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| Colour Index | 11110 |
| form | neat |
| pka | 14.55±0.10(Predicted) |
| color | Dark Red to Very Dark Red |
| Water Solubility | 169.7ug/L(25 ºC) |
| λmax | 502 nm |
| BRN | 5353614 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C16H18N4O3/c1-2-19(11-12-21)15-7-3-13(4-8-15)17-18-14-5-9-16(10-6-14)20(22)23/h3-10,21H,2,11-12H2,1H3/b18-17+ |
| InChIKey | FOQABOMYTOFLPZ-ISLYRVAYSA-N |
| SMILES | CCN(CCO)c1ccc(cc1)\N=N\c2ccc(cc2)[N+]([O-])=O |
| CAS DataBase Reference | 2872-52-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanol, 2-[ethyl[4-[(4-nitrophenyl)azo]phenyl]amino]-(2872-52-8) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | KL0320000 |
| TSCA | TSCA listed |
| HS Code | 32041100 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |