
269410-08-4
| Name | Pyrazole-4-boronic acid pinacol ester |
| CAS | 269410-08-4 |
| EINECS(EC#) | 629-131-7 |
| Molecular Formula | C9H17BN2O3 |
| MDL Number | MFCD03453063 |
| Molecular Weight | 212.05 |
| MOL File | 269410-08-4.mol |
Chemical Properties
| Appearance | Off-white to tan powder |
| Melting point | 142-146 °C (lit.) |
| Boiling point | 335.4±15.0 °C(Predicted) |
| density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator (+4°C) |
| solubility | DMSO, Ethyl Acetate, Methanol |
| form | Powder |
| pka | 13.36±0.50(Predicted) |
| color | Off-white to tan |
| Water Solubility | insoluble |
| InChI | InChI=1S/C9H15BN2O2/c1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7/h5-6H,1-4H3,(H,11,12) |
| InChIKey | TVOJIBGZFYMWDT-UHFFFAOYSA-N |
| SMILES | N1C=C(B2OC(C)(C)C(C)(C)O2)C=N1 |
| CAS DataBase Reference | 269410-08-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant/Flammable |
| TSCA | No |
| REACH Registrations | Active |
| HS Code | 29349900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
