181219-01-2
| Name | 4-Pyridineboronic acid pinacol ester |
| CAS | 181219-01-2 |
| EINECS(EC#) | 628-005-9 |
| Molecular Formula | C11H18BNO3 |
| MDL Number | MFCD01319051 |
| Molecular Weight | 223.08 |
| MOL File | 181219-01-2.mol |
Chemical Properties
| Appearance | white to off-white powder |
| Melting point | 149-153 °C (lit.) |
| Boiling point | 300.9±15.0 °C(Predicted) |
| density | 1.03±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator (+4°C) |
| form | Powder |
| pka | 4.32±0.10(Predicted) |
| color | White to off-white |
| Water Solubility | Insoluble |
| BRN | 7919059 |
| InChI | 1S/C11H16BNO2/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9/h5-8H,1-4H3 |
| InChIKey | NLTIETZTDSJANS-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2ccncc2 |
| CAS DataBase Reference | 181219-01-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C,F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |