26177-43-5
| Name | 3-Nitrobenzylammonium hydrochloride |
| CAS | 26177-43-5 |
| EINECS(EC#) | 247-502-8 |
| Molecular Formula | C7H10ClN2O2+ |
| MDL Number | MFCD00012858 |
| Molecular Weight | 189.62 |
| MOL File | 26177-43-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 229-231 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| color | Off-white to tan |
| InChI | 1S/C7H8N2O2.ClH/c8-5-6-2-1-3-7(4-6)9(10)11;/h1-4H,5,8H2;1H |
| InChIKey | DLZXLCHQWOZGSE-UHFFFAOYSA-N |
| SMILES | Cl.NCc1cccc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 26177-43-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |