
18600-42-5
| Name | 4-Nitrobenzylamine hydrochloride |
| CAS | 18600-42-5 |
| EINECS(EC#) | 242-441-3 |
| Molecular Formula | C7H9ClN2O2 |
| MDL Number | MFCD00012863 |
| Molecular Weight | 188.61 |
| MOL File | 18600-42-5.mol |
Chemical Properties
| Appearance | light brown crystalline solid |
| Melting point | ~265 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | methanol:glacial acetic acid (1:1): soluble25mg/mL, clear, colorless to light yellow |
| form | powder to crystal |
| color | White to Light yellow |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, oxidizing agents. |
| Water Solubility | almost transparency |
| BRN | 3629994 |
| InChI | InChI=1S/C7H8N2O2.ClH/c8-5-6-1-3-7(4-2-6)9(10)11;/h1-4H,5,8H2;1H |
| InChIKey | SMIXZZMSWYOQPW-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)C=CC(CN)=CC=1.Cl |
| CAS DataBase Reference | 18600-42-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DP6705000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
