24390-14-5
| Name | Doxycycline hyclate |
| CAS | 24390-14-5 |
| EINECS(EC#) | 2017-001-1 |
| Molecular Formula | C22H26N2O9 |
| MDL Number | MFCD02682958 |
| Molecular Weight | 462.45 |
| MOL File | 24390-14-5.mol |
Chemical Properties
| Melting point | 206-209?C (dec.) |
| alpha | D25 -110° (c = 1 in 0.01N methanolic HCl) |
| RTECS | QI8925000 |
| storage temp. | Store at +4°C |
| solubility | H2O: soluble50mg/mL |
| form | Yellow to yellow-green crystalline solid |
| color | yellow to greenish-yellow |
| biological source | synthetic |
| Water Solubility | Soluble in water to 50mg/ml. May require warming.Soluble in water, methanol. Sparingly soluble in ethanol. Insoluble in chloroform and ether. |
| Merck | 14,3440 |
| BRN | 5702728 |
| Major Application | clinical testing |
| InChIKey | HALQELOKLVRWRI-VDBOFHIQSA-N |
| SMILES | C(O)C.O[C@@]12C(C(C(=O)N)=C(O)[C@@H](N(C)C)[C@]1([H])[C@H]([C@]1([H])[C@H](C3C=CC=C(O)C=3C(=O)C1=C2O)C)O)=O.Cl |&1:4,12,16,18,19,21,r| |
Safety Data
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H361fd-H410 |
| Precautionary statements | P202-P261-P273-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29413000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |