2058-46-0
| Name | Oxytetracycline hydrochloride |
| CAS | 2058-46-0 |
| EINECS(EC#) | 218-161-2 |
| Molecular Formula | C22H25ClN2O9 |
| MDL Number | MFCD00135815 |
| Molecular Weight | 496.89 |
| MOL File | 2058-46-0.mol |
Chemical Properties
| Appearance | Yellow Crystalline Solid |
| Melting point | 180°C |
| alpha | -188～-200°(D/20℃)(c=1,0.1mol/l HCl) (calculated on the dried basis) |
| storage temp. | 0-6°C |
| solubility | Freely soluble in water, sparingly soluble in ethanol (96 per cent). Solutions in water become turbid on standing, owing to the precipitation of oxytetracycline. |
| form | crystalline |
| color | yellow |
| PH | 2.0～3.0 (10g/l, 25℃) |
| Optical Rotation | [α]/D -190 to -200°, c =1 in 0.1 M HCl (anhydrous basis) |
| Water Solubility | >100 g/L |
| Sensitive | Light Sensitive |
| Usage | Antibiotic substance isolated from the elaboration products of the actinomycete, Streptomyces rimosus, grown on a suitable medium. Antibacterial |
| λmax | 360nm(H2O)(lit.) |
| Merck | 13,7046 |
| BRN | 3853107 |
| Stability: | Hygroscopic |
| Major Application | cleaning products clinical cosmetics environmental food and beverages forensics and toxicology personal care pharmaceutical (small molecule) |
| InChIKey | UBDNTYUBJLXUNN-IFLJXUKPSA-N |
| SMILES | Cl.CN(C)[C@H]1[C@@H]2[C@@H](O)[C@H]3C(=C(O)[C@]2(O)C(=O)C(C(N)=O)=C1O)C(=O)c4c(O)cccc4[C@@]3(C)O |
Safety Data
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361fd |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | QI8225000 |
| F | 8-10-23 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29413000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |
| Toxicity |