
64-75-5
| Name | Tetracycline hydrochloride |
| CAS | 64-75-5 |
| EINECS(EC#) | 200-593-8 |
| Molecular Formula | C22H25ClN2O8 |
| MDL Number | MFCD00078142 |
| Molecular Weight | 480.9 |
| MOL File | 64-75-5.mol |
Chemical Properties
| Appearance | Yellow crystalline powder |
| Melting point | 220-223 °C(lit.) |
| alpha | -252 º (c=0.5, H2O) |
| refractive index | -253 ° (C=0.5, 0.1mol/L HCl) |
| storage temp. | 2-8°C |
| solubility | H2O: 10 mg/mL as a stock solution. Stock solutions should be filtered sterilized and stored at −20°C. Stable at 37°C for 4 days. |
| form | powder |
| color | faint yellow to yellow |
| PH | pH(10g/l, 25℃) : 1.8~3.0 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Optical Rotation | [α]/D -255 to 240° (Specific rotation ) |
| Water Solubility | 50 g/L |
| Sensitive | Air & Light Sensitive |
| Merck | 14,9196 |
| BRN | 3844873 |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | XMEVHPAGJVLHIG-FMZCEJRJSA-N |
| SMILES | Cl.CN(C)[C@H]1[C@@H]2C[C@H]3C(=C(O)[C@]2(O)C(=O)C(C(N)=O)=C1O)C(=O)c4c(O)cccc4[C@@]3(C)O |
| CAS DataBase Reference | 64-75-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H361fd-H410 |
| Precautionary statements | P202-P261-P273-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | QI9100000 |
| F | 8-10-23 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 3 |
| HS Code | 29413000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
| Safety Profile | |
| Toxicity |


