2434-53-9
| Name | 6-Amino-1-methyluracil |
| CAS | 2434-53-9 |
| EINECS(EC#) | 219-422-3 |
| Molecular Formula | C5H7N3O2 |
| MDL Number | MFCD00075366 |
| Molecular Weight | 141.13 |
| MOL File | 2434-53-9.mol |
Chemical Properties
| Appearance | almost white to slightly beige crystalline powder |
| Melting point | 300 °C |
| density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in diluted sodium hydroxide solution. |
| form | powder to crystal |
| pka | 9.26±0.40(Predicted) |
| color | White to Almost white |
| Detection Methods | HPLC |
| BRN | 127771 |
| InChI | InChI=1S/C5H7N3O2/c1-8-3(6)2-4(9)7-5(8)10/h2H,6H2,1H3,(H,7,9,10) |
| InChIKey | GZLZRPNUDBIQBM-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)C(N)=CC(=O)N1 |
| CAS DataBase Reference | 2434-53-9(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
