
24241-18-7
| Name | 2-Amino-3,5-dibromopyrazine |
| CAS | 24241-18-7 |
| Molecular Formula | C4H3Br2N3 |
| MDL Number | MFCD00673150 |
| Molecular Weight | 252.89 |
| MOL File | 24241-18-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 114-117 °C (lit.) |
| Boiling point | 294.6±35.0 °C(Predicted) |
| density | 2.287±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 0.81±0.10(Predicted) |
| color | Yellow to brown |
| InChI | InChI=1S/C4H3Br2N3/c5-2-1-8-4(7)3(6)9-2/h1H,(H2,7,8) |
| InChIKey | DTLBKXRFWUERQN-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)N=C1Br |
| CAS DataBase Reference | 24241-18-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335-H319 |
| Precautionary statements | P280g-P261-P280-P301+P310-P305+P351+P338-P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |


