2298-07-9
| Name | 4-Bromo-1-naphthylamine |
| CAS | 2298-07-9 |
| EINECS(EC#) | 218-944-9 |
| Molecular Formula | C10H8BrN |
| MDL Number | MFCD00004023 |
| Molecular Weight | 222.08 |
| MOL File | 2298-07-9.mol |
Chemical Properties
| Melting point | 102-103 °C(lit.) |
| Boiling point | 338.4±17.0 °C(Predicted) |
| density | 1.563±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.93±0.10(Predicted) |
| color | White to Amber to Dark purple |
| InChI | InChI=1S/C10H8BrN/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H,12H2 |
| InChIKey | LIUKLAQDPKYBCP-UHFFFAOYSA-N |
| SMILES | C1(N)=C2C(C=CC=C2)=C(Br)C=C1 |
| CAS DataBase Reference | 2298-07-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
