2082-84-0
| Name | Decyltrimethylammonium bromide |
| CAS | 2082-84-0 |
| EINECS(EC#) | 218-219-7 |
| Molecular Formula | C13H30BrN |
| MDL Number | MFCD00041973 |
| Molecular Weight | 280.29 |
| MOL File | 2082-84-0.mol |
Chemical Properties
| Appearance | white to beige chunks and powder |
| Melting point | 243 °C |
| density | 1.1819 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Chunks and Powder |
| color | White to beige |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3915222 |
| InChI | 1S/C13H30N.BrH/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;/h5-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PLMFYJJFUUUCRZ-UHFFFAOYSA-M |
| SMILES | [Br-].CCCCCCCCCC[N+](C)(C)C |
| CAS DataBase Reference | 2082-84-0(CAS DataBase Reference) |
| Storage Precautions | Store under inert gas |
| EPA Substance Registry System | 2082-84-0(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | BP6352000 |
| F | 3-10 |
| TSCA | Yes |
| HS Code | 29211990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |