2390-68-3
| Name | Didecyldimethylammonium bromide |
| CAS | 2390-68-3 |
| EINECS(EC#) | 219-234-1 |
| Molecular Formula | C22H48BrN |
| MDL Number | MFCD00012194 |
| Molecular Weight | 406.53 |
| MOL File | 2390-68-3.mol |
Chemical Properties
| Appearance | off-white powder and chunks |
| Melting point | 149-151 °C (lit.) |
| refractive index | 1.4570 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| color | White to Almost white |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| BRN | 6492993 |
| InChI | InChI=1S/C22H48N.BrH/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;/h5-22H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | UMGXUWVIJIQANV-UHFFFAOYSA-M |
| SMILES | C(CCCCCCCCC)[N+](C)(C)CCCCCCCCCC.[Br-] |
| CAS DataBase Reference | 2390-68-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |