2039-88-5
| Name | 2-Bromostyrene |
| CAS | 2039-88-5 |
| EINECS(EC#) | 218-027-3 |
| Molecular Formula | C8H7Br |
| MDL Number | MFCD00000076 |
| Molecular Weight | 183.05 |
| MOL File | 2039-88-5.mol |
Chemical Properties
| Appearance | Clear colorless liquid |
| Melting point | 7°C |
| Boiling point | 102-104 °C/22 mmHg (lit.) |
| density | 1.46 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 186 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with methanol. |
| form | clear liquid |
| color | Colorless to Yellow |
| Specific Gravity | 1.4160 |
| BRN | 2323537 |
| InChI | InChI=1S/C8H7Br/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2 |
| InChIKey | SSZOCHFYWWVSAI-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC=C1C=C |
| CAS DataBase Reference | 2039-88-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2-ethenyl-(2039-88-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
