2039-86-3
| Name | 3-Bromostyrene |
| CAS | 2039-86-3 |
| EINECS(EC#) | 218-025-2 |
| Molecular Formula | C8H7Br |
| MDL Number | MFCD00000088 |
| Molecular Weight | 183.05 |
| MOL File | 2039-86-3.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Boiling point | 74-75 °C/3 mmHg (lit.) |
| density | 1.406 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 154 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.406 |
| BRN | 2038490 |
| InChI | InChI=1S/C8H7Br/c1-2-7-4-3-5-8(9)6-7/h2-6H,1H2 |
| InChIKey | KQJQPCJDKBKSLV-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(C=C)=C1 |
| CAS DataBase Reference | 2039-86-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-BrC6H4CH=CH2(2039-86-3) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |