32862-97-8
| Name | 3-Bromocinnamic acid |
| CAS | 32862-97-8 |
| EINECS(EC#) | 251-267-7 |
| Molecular Formula | C9H7BrO2 |
| MDL Number | MFCD00004382 |
| Molecular Weight | 227.05 |
| MOL File | 32862-97-8.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 177-179 °C(lit.) |
| Boiling point | 344.1±25.0 °C(Predicted) |
| density | 1.5403 (rough estimate) |
| refractive index | 1.5627 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: soluble |
| form | Crystalline Powder |
| pka | 4.27±0.10(Predicted) |
| color | White to light yellow |
| InChI | InChI=1S/C9H7BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,(H,11,12) |
| InChIKey | YEMUSDCFQUBPAL-SNAWJCMRSA-N |
| SMILES | C(O)(=O)C=CC1=CC=CC(Br)=C1 |
| CAS DataBase Reference | 32862-97-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Bromocinnamic acid(32862-97-8) |
| EPA Substance Registry System | 32862-97-8(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | GD8420000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |