20265-37-6
| Name | 3-Methoxy-2-nitropyridine |
| CAS | 20265-37-6 |
| EINECS(EC#) | 606-480-3 |
| Molecular Formula | C6H6N2O3 |
| MDL Number | MFCD00222276 |
| Molecular Weight | 154.12 |
| MOL File | 20265-37-6.mol |
Chemical Properties
| Melting point | 73-76 °C (lit.) |
| Boiling point | 311.8±22.0 °C(Predicted) |
| density | 1.300±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -6.34±0.10(Predicted) |
| color | White to Yellow to Green |
| Detection Methods | HPLC,NMR |
| InChI | InChI=1S/C6H6N2O3/c1-11-5-3-2-4-7-6(5)8(9)10/h2-4H,1H3 |
| InChIKey | QRCUQLANPHYVEH-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=CC=C1OC |
| CAS DataBase Reference | 20265-37-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |