
19235-89-3
| Name | 4-CHLORO-PYRIDINE-2-CARBONITRILE |
| CAS | 19235-89-3 |
| EINECS(EC#) | 606-272-2 |
| Molecular Formula | C6H3ClN2 |
| MDL Number | MFCD06009833 |
| Molecular Weight | 138.55 |
| MOL File | 19235-89-3.mol |
Chemical Properties
| Melting point | 81-85 °C |
| Boiling point | 231.6±20.0 °C(Predicted) |
| density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | -2.74±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C6H3ClN2/c7-5-1-2-9-6(3-5)4-8/h1-3H |
| InChIKey | DYEZRXLVZMZHQT-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC(Cl)=C1 |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H301-H318 |
| Precautionary statements | P264-P270-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501-P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |


