
114772-54-2
| Name | 4-Bromomethyl-2-cyanobiphenyl |
| CAS | 114772-54-2 |
| EINECS(EC#) | 425-280-5 |
| Molecular Formula | C14H10BrN |
| MDL Number | MFCD00671503 |
| Molecular Weight | 272.14 |
| MOL File | 114772-54-2.mol |
Chemical Properties
| Appearance | Cream powder |
| Melting point | 125-128 °C (lit.) |
| Boiling point | 413.2±38.0 °C(Predicted) |
| density | 1.43±0.1 g/cm3(Predicted) |
| vapor pressure | 0.1-0.2Pa at 20-25℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C14H10BrN/c15-9-11-5-7-12(8-6-11)14-4-2-1-3-13(14)10-16/h1-8H,9H2 |
| InChIKey | LFFIEVAMVPCZNA-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CBr)C=C2)=CC=CC=C1C#N |
| LogP | 3.2 |
| CAS DataBase Reference | 114772-54-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |

