
327056-62-2
| Name | 2-Cyano-5-fluoropyridine |
| CAS | 327056-62-2 |
| EINECS(EC#) | 627-618-9 |
| Molecular Formula | C6H3FN2 |
| MDL Number | MFCD08741371 |
| Molecular Weight | 122.1 |
| MOL File | 327056-62-2.mol |
Chemical Properties
| Melting point | 41-44°C |
| Boiling point | 214.9±20.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| Fp | 99 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -2.74±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H3FN2/c7-5-1-2-6(3-8)9-4-5/h1-2,4H |
| InChIKey | BHXHRMVSUUPOLX-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(F)C=C1 |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 |


