210169-05-4
| Name | 3-AMINO-5-FLUOROPYRIDINE |
| CAS | 210169-05-4 |
| EINECS(EC#) | 664-255-5 |
| Molecular Formula | C5H5FN2 |
| MDL Number | MFCD00234073 |
| Molecular Weight | 112.11 |
| MOL File | 210169-05-4.mol |
Chemical Properties
| Appearance | Light yellow Cryst |
| Melting point | 86°C |
| Boiling point | 232.7±20.0 °C(Predicted) |
| density | 1.257±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 3.74±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C5H5FN2/c6-4-1-5(7)3-8-2-4/h1-3H,7H2 |
| InChIKey | ZRORIJXOWXYPMO-UHFFFAOYSA-N |
| SMILES | C1=NC=C(F)C=C1N |
| CAS DataBase Reference | 210169-05-4(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |