17524-05-9
| Name | Molybdenyl acetylacetonate |
| CAS | 17524-05-9 |
| EINECS(EC#) | 241-522-0 |
| Molecular Formula | C10H14MoO6 |
| MDL Number | MFCD00011506 |
| Molecular Weight | 326.15 |
| MOL File | 17524-05-9.mol |
Chemical Properties
| Appearance | light yellow, greyish green to yellow-brown |
| Melting point | 184 °C (dec.)(lit.) |
| density | 1,64 g/cm3 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder |
| color | Pale yellow |
| Specific Gravity | 1.640 |
| Water Solubility | 8.52 g/100 mL (20 ºC) |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Air Sensitive |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 1000 mg/m3 |
| InChI | InChI=1S/2C5H8O2.Mo.2O/c2*1-4(6)3-5(2)7;;;/h2*3,6H,1-2H3;;;/q;;+2;;/p-2/b2*4-3-;;; |
| InChIKey | SKMUJBBRXZPAJY-VGKOASNMSA-L |
| SMILES | [Mo](=O)(=O)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C |
| NIST Chemistry Reference | Molybdenyl acetylacetonate(17524-05-9) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29144000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |