15170-57-7
| Name | Platinum bis(acetylacetonate) |
| CAS | 15170-57-7 |
| EINECS(EC#) | 239-223-5 |
| Molecular Formula | C10H14O4Pt |
| MDL Number | MFCD00000028 |
| Molecular Weight | 393.29 |
| MOL File | 15170-57-7.mol |
Chemical Properties
| Appearance | yellow to yellow-green powder |
| Melting point | 249-252 °C(lit.) |
| Fp | 170°C |
| storage temp. | Store below +30°C. |
| solubility | soluble in Acetone |
| form | Powder |
| color | Yellow to yellow-green |
| Specific Gravity | 2.336 |
| Water Solubility | insoluble |
| Sublimation | 170 ºC |
| BRN | 4136189 |
| InChI | InChI=1S/2C5H8O2.Pt/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | KLFRPGNCEJNEKU-FDGPNNRMSA-L |
| SMILES | O([Pt]O/C(/C)=C\C(=O)C)/C(/C)=C\C(=O)C |
| NIST Chemistry Reference | Platinum bis(acetylacetonate)(15170-57-7) |
| EPA Substance Registry System | Platinum, bis(2,4-pentanedionato-.kappa. O,.kappa.O')-, (SP-4-1)-(15170-57-7) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H361 |
| Precautionary statements | P201-P280-P301+P312+P330-P302+P352+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| TSCA | Yes |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |