14024-63-6
| Name | Zinc(II) acetylacetonate |
| CAS | 14024-63-6 |
| EINECS(EC#) | 237-860-3 |
| Molecular Formula | C10H14O4Zn |
| MDL Number | MFCD00000035 |
| Molecular Weight | 263.61 |
| MOL File | 14024-63-6.mol |
Chemical Properties
| Appearance | White to ivory powder |
| Melting point | 124-126 °C |
| Boiling point | 129-131 °C (10 mmHg) |
| bulk density | 500kg/m3 |
| density | 1.544[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Store below +30°C. |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 8.8[at 20 ℃] |
| color | White to ivory |
| PH | 10 (20°C, 4g/L in H2O) |
| Water Solubility | 9.1g/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/2C5H7O2.Zn/c2*1-4(6)3-5(2)7;/h2*3H,1-2H3;/q2*-1;+2 |
| InChIKey | NHXVNEDMKGDNPR-UHFFFAOYSA-N |
| SMILES | [Zn+2].O=C([C-H]C(=O)C)C.O=C([C-H]C(=O)C)C |
| LogP | 0.2 at 22℃ |
| Uses |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H319-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 1 |
| RTECS | ZH0917500 |
| Autoignition Temperature | 580°C |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29141900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Eye Irrit. 2 Skin Sens. 1B |