10210-64-7
| Name | BERYLLIUM 2,4-PENTANEDIONATE |
| CAS | 10210-64-7 |
| EINECS(EC#) | 233-513-5 |
| Molecular Formula | C10H14BeO4 |
| MDL Number | MFCD00013485 |
| Molecular Weight | 207.23 |
| MOL File | 10210-64-7.mol |
Chemical Properties
| Appearance | Crystalline powder. Freely soluble in alcohol and ether; slightly soluble in water. Resistant to hydrolysis. A chelating nonionizing compound. |
| Melting point | 100-104 °C(lit.) |
| Boiling point | 270 °C(lit.) |
| density | 1.168 g/mL at 25 °C(lit.) |
| Fp | 270°C |
| solubility | insoluble in H2O; very soluble in ethanol, ethyl ether |
| form | Powder |
| color | White |
| Specific Gravity | 1.168 |
| Water Solubility | insoluble H2O, hydrolyzed in boiling H2O [MER06]; very soluble alcohol, ether [HAW93] |
| Hydrolytic Sensitivity | 5: forms reversible hydrate |
| Merck | 13,1167 |
| Exposure limits | ACGIH: TWA 0.00005 mg/m3 OSHA: Ceiling 2 μg/m3 NIOSH: IDLH 4 mg/m3; Ceiling 0.0005 mg/m3 |
| InChI | InChI=1S/2C5H8O2.Be/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | BBKXDHBLPBKCFR-FDGPNNRMSA-L |
| SMILES | O([Be]O/C(/C)=C\C(=O)C)/C(/C)=C\C(=O)C |
Safety Data
| Hazard Codes | T+,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1566 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 Carc. 1B Inhalation Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 1 Inhalation STOT SE 3 |