14024-18-1
| Name | Ferric acetylacetonate |
| CAS | 14024-18-1 |
| EINECS(EC#) | 237-853-5 |
| Molecular Formula | C15H21FeO6 |
| MDL Number | MFCD00000020 |
| Molecular Weight | 353.17 |
| MOL File | 14024-18-1.mol |
Chemical Properties
| Appearance | dark red powder |
| Melting point | 180-182 °C (dec.)(lit.) |
| Boiling point | 110°C 2mm |
| bulk density | 500kg/m3 |
| density | 5.24 g/mL at 25 °C(lit.) |
| vapor pressure | 2.6 hPa (110 °C) |
| storage temp. | Store below +30°C. |
| solubility | Soluble in toluene. |
| form | Powder |
| color | Red |
| Specific Gravity | 5.24 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Water Solubility | 2 g/L (20 ºC) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4157960 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| InChI | 1S/3C5H8O2.Fe/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | AQBLLJNPHDIAPN-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[Fe](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H318 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | NO8960000 |
| F | 21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 |
| Toxicity |