15635-87-7
| Name | Iridium(III) acetylacetonate |
| CAS | 15635-87-7 |
| EINECS(EC#) | 239-711-8 |
| Molecular Formula | C15H21IrO6 |
| MDL Number | MFCD00015353 |
| Molecular Weight | 489.54 |
| MOL File | 15635-87-7.mol |
Chemical Properties
| Appearance | orange-yellow crystals |
| Melting point | 269-271 °C(lit.) |
| Boiling point | 260°C/1mmHg |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | slightly soluble in H2O; soluble in toluene, chloroform,acetone, methanol |
| form | Crystalline |
| color | Orange-yellow |
| Water Solubility | Insoluble in water; soluble in chloroform and benzene; slightly soluble in ethanol and methanol. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/3C5H8O2.Ir/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | HLYTZTFNIRBLNA-LNTINUHCSA-K |
| SMILES | [Ir](O/C(/C)=C\C(=O)C)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C |
| NIST Chemistry Reference | Iridium, tris(2,4-pentanedionato-o,o')-, (oc-6-11)-(15635-87-7) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
