13476-99-8
| Name | VANADIUM(III) ACETYLACETONATE |
| CAS | 13476-99-8 |
| EINECS(EC#) | 236-759-1 |
| Molecular Formula | C15H21O6V |
| MDL Number | MFCD00000033 |
| Molecular Weight | 348.27 |
| MOL File | 13476-99-8.mol |
Chemical Properties
| Appearance | Blue to blue-green crystals. Decomposes before melting. |
| Melting point | 181-184 °C(lit.) |
| Boiling point | 170°C 0,05mm |
| density | 1.050 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in methanol, acetone, benzene chloroform |
| form | crystal |
| color | brown |
| Water Solubility | Soluble in water 2g/L, toluene, ethanol, acetone. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Air Sensitive |
| BRN | 4148970 |
| Exposure limits | NIOSH: Ceiling 0.05 mg/m3 |
| InChI | 1S/3C5H8O2.V/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | JTPOGAMSYINTGF-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[V](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP | 0.05 |
| Uses | |
| CAS DataBase Reference | 13476-99-8 |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3285 6.1/PG 3 |
| WGK Germany | 3 |
| F | 23-10 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |