68488-07-3
| Name | Magnesium acetylacetonate dihydrate |
| CAS | 68488-07-3 |
| EINECS(EC#) | 628-792-9 |
| Molecular Formula | C10H18MgO6 |
| MDL Number | MFCD00150168 |
| Molecular Weight | 258.55 |
| MOL File | 68488-07-3.mol |
Chemical Properties
| Melting point | 265 °C (dec.)(lit.) |
| storage temp. | Store at room temperature, keep dry and cool |
| form | solid |
| Specific Gravity | 1.356 |
| Appearance | White to off-white Powder |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/2C5H8O2.Mg.2H2O/c2*1-4(6)3-5(2)7;;;/h2*3,6H,1-2H3;;2*1H2/q;;+2;;/p-2/b2*4-3-;;; |
| InChIKey | LDRHDOBLZDBGOP-VGKOASNMSA-L |
| SMILES | O.O.CC(=O)\C=C(\C)O[Mg]O\C(C)=C/C(C)=O |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |