164014-95-3
| Name | 1,4-Benzodioxane-6-boronic acid |
| CAS | 164014-95-3 |
| EINECS(EC#) | 625-755-9 |
| Molecular Formula | C8H9BO4 |
| MDL Number | MFCD01009696 |
| Molecular Weight | 179.97 |
| MOL File | 164014-95-3.mol |
Chemical Properties
| Appearance | White to light yellow crystal powder |
| Melting point | 187 °C |
| Boiling point | 361.0±52.0 °C(Predicted) |
| density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder |
| pka | 8.52±0.20(Predicted) |
| color | white to off-white |
| Detection Methods | HPLC |
| BRN | 7478648 |
| InChI | InChI=1S/C8H9BO4/c10-9(11)6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5,10-11H,3-4H2 |
| InChIKey | SQDUGGGBJXULJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C2OCCOC2=C1)(O)O |
| CAS DataBase Reference | 164014-95-3(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |