161308-36-7
| Name | N-(2-Hydroxyethyl)piperazine-N'-(4-butanesulfonic acid) |
| CAS | 161308-36-7 |
| EINECS(EC#) | 629-081-6 |
| Molecular Formula | C10H22N2O4S |
| MDL Number | MFCD22576931 |
| Molecular Weight | 266.36 |
| MOL File | 161308-36-7.mol |
Chemical Properties
| density | 1.251±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: 0.5 g/mL, clear to slightly hazy, colorless to faintly yellow |
| form | Solid |
| color | White to off-white |
| PH | 7.6-9.0 |
| PH Range | 7.6 - 9.0 |
| pka | 8.3(at 25℃) |
| Water Solubility | water: 0.5g/mL, clear to slightly hazy, colorless to faintly yellow |
| Major Application | diagnostic assay manufacturing |
| InChI | 1S/C10H22N2O4S/c13-9-8-12-6-4-11(5-7-12)3-1-2-10-17(14,15)16/h13H,1-10H2,(H,14,15,16) |
| InChIKey | LOJNFONOHINEFI-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)(O)CCCCN1CCN(CC1)CCO |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |