
36635-61-7
| Name | Tosylmethyl isocyanide |
| CAS | 36635-61-7 |
| EINECS(EC#) | 253-140-1 |
| Molecular Formula | C9H9NO2S |
| MDL Number | MFCD00000005 |
| Molecular Weight | 195.24 |
| MOL File | 36635-61-7.mol |
Chemical Properties
| Appearance | Pale yellow to light brown crystalline powder |
| Melting point | 109-113 °C(lit.) |
| density | 1.2721 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | -20°C |
| solubility | water: slightly soluble |
| form | Liquid |
| color | Clear |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Merck | 9556 |
| BRN | 3592382 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C9H9NO2S/c1-8-3-5-9(6-4-8)13(11,12)7-10-2/h3-6H,7H2,1H3 |
| InChIKey | BBNNLJMGPASZPD-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(C)=CC=1)(=O)(=O)C[N+]#[C-] |
| CAS DataBase Reference | 36635-61-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P262-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 21 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29299000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral |

