1575-37-7
| Name | 4-Bromo-1,2-benzenediamine |
| CAS | 1575-37-7 |
| Molecular Formula | C6H7BrN2 |
| MDL Number | MFCD02660622 |
| Molecular Weight | 187.04 |
| MOL File | 1575-37-7.mol |
Chemical Properties
| Melting point | 65-69 °C (dec.)(lit.) |
| Boiling point | 289.3±20.0 °C(Predicted) |
| density | 1.697±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform. |
| form | powder to crystal |
| pka | 3.46±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C6H7BrN2/c7-4-1-2-5(8)6(9)3-4/h1-3H,8-9H2 |
| InChIKey | WIHHVKUARKTSBU-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1N |
| CAS DataBase Reference | 1575-37-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H319 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29215110 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
