14918-69-5
| Name | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE |
| CAS | 14918-69-5 |
| Molecular Formula | C10H4Cl2O4 |
| MDL Number | MFCD00075261 |
| Molecular Weight | 259.04 |
| MOL File | 14918-69-5.mol |
Chemical Properties
| Appearance | DARK PURPLE POWDER |
| Melting point | 197-199 °C (lit.) |
| Boiling point | 366.21°C (rough estimate) |
| density | 1.5311 (rough estimate) |
| refractive index | 1.5110 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) |
| form | powder to crystal |
| pka | 5.84±0.20(Predicted) |
| color | Orange to Brown to Dark red |
| InChI | 1S/C10H4Cl2O4/c11-7-8(12)10(16)6-4(14)2-1-3(13)5(6)9(7)15/h1-2,13-14H |
| InChIKey | UVESKDKGJSABKP-UHFFFAOYSA-N |
| SMILES | Oc1ccc(O)c2C(=O)C(Cl)=C(Cl)C(=O)c12 |
| CAS DataBase Reference | 14918-69-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2914.79.4000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |